cas: 180134-14-9 — see every product listed under this CAS number, including other names
2-Methoxy-4,6-bis(trifluoromethyl)benzaldehyde (CAS 180134-14-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F342614-5G |
| cas | 180134-14-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1388.07 Pln | |
| Fluorochem | 10g | 2314.83 Pln |
| delivery time | 3-4 weeks |
|---|
2-methoxy-4,6-bis(trifluoromethyl)benzaldehyde (CAS 180134-14-9) is a chemical compound with the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. IUPAC name: 2-methoxy-4,6-bis(trifluoromethyl)benzaldehyde. InChIKey: IEENEJLKQKCCDD-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 2-methoxy-4,6-bis(trifluoromethyl)benzaldehyde |
| InChIKey | IEENEJLKQKCCDD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1C=O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)