CAS 1706436-17-0 appears in our catalog under these names: 4-Methyl-2,5-bis(trifluoromethyl)benzoic acid, 95%, 4-Methyl-2,5-bis(trifluoromethyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
4-methyl-2,5-bis(trifluoromethyl)benzoic acid (CAS 1706436-17-0) is a chemical compound with the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. IUPAC name: 4-methyl-2,5-bis(trifluoromethyl)benzoic acid. InChIKey: XONWPGMYEQXSBC-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 4-methyl-2,5-bis(trifluoromethyl)benzoic acid |
| InChIKey | XONWPGMYEQXSBC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(F)(F)F)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)