Products 197015-73-9
CAS 197015-73-9 is the registry number for 3,5-Bis(trifluoromethyl)-2-methoxybenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-methoxy-3,5-bis(trifluoromethyl)benzaldehyde (CAS 197015-73-9) is a chemical compound with the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. IUPAC name: 2-methoxy-3,5-bis(trifluoromethyl)benzaldehyde. InChIKey: GNSORUQMVLHNIN-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 2-methoxy-3,5-bis(trifluoromethyl)benzaldehyde |
| InChIKey | GNSORUQMVLHNIN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C=O |
Computed by PubChem (NCBI)