CAS 55321-69-2 appears in our catalog under these names: 4-(1,1,2,3,3,3-Hexafluoropropoxy)benzaldehyde, 95%, 4-(1,1,2,3,3,3-Hexafluoropropoxy)benzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
4-(1,1,2,3,3,3-hexafluoropropoxy)benzaldehyde (CAS 55321-69-2) is a chemical compound with the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. IUPAC name: 4-(1,1,2,3,3,3-hexafluoropropoxy)benzaldehyde. InChIKey: NAFDJEVVAKIWJK-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 4-(1,1,2,3,3,3-hexafluoropropoxy)benzaldehyde |
| InChIKey | NAFDJEVVAKIWJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)OC(C(C(F)(F)F)F)(F)F |
Computed by PubChem (NCBI)