Products 302912-02-3
CAS 302912-02-3 appears in our catalog under these names: 2,5-Bis(trifluoromethyl)phenylacetic acid, 97%, 2,5-Bis(trifluoromethyl)phenylacetic acid, 95%, 2-(2,5-Bis(trifluoromethyl)phenyl)acetic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-[2,5-bis(trifluoromethyl)phenyl]acetic acid (CAS 302912-02-3) is a chemical compound with the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. IUPAC name: 2-[2,5-bis(trifluoromethyl)phenyl]acetic acid. InChIKey: AWTNYFICBCCTBY-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 2-[2,5-bis(trifluoromethyl)phenyl]acetic acid |
| InChIKey | AWTNYFICBCCTBY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
2,5-Bis(trifluoromethyl)phenylacetic acid, 2-[2,5-bis(trifluoromethyl)phenyl]acetic Acid, 2-(2,5-Bis(trifluoromethyl)phenyl)acetic acid, [2,5-bis(trifluoromethyl)phenyl]acetic acid, Benzeneacetic acid, 2,5-bis(trifluoromethyl)-, AWTNYFICBCCTBY-UHFFFAOYSA-N, 2,5-Bis(trifluoromethyl)phenylacetic acid, 97%