cas: 1027888-79-4 — see every product listed under this CAS number, including other names
2-Methoxy-4-(trifluoromethyl)phenol 97% (CAS 1027888-79-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A249108-100mg |
| cas | 1027888-79-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 2500.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A249108 |
2-methoxy-4-(trifluoromethyl)phenol (CAS 1027888-79-4) is a chemical compound with the molecular formula C8H7F3O2 and a molecular weight of 192.13 g/mol. IUPAC name: 2-methoxy-4-(trifluoromethyl)phenol. InChIKey: WULGVCJGJHHILR-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O2 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 2-methoxy-4-(trifluoromethyl)phenol |
| InChIKey | WULGVCJGJHHILR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(F)(F)F)O |
Computed by PubChem (NCBI)