2-Methoxy-5-(trifluoromethyl)benzoic acid, 98%
cas: 4864-01-1 — see every product listed under this CAS number, including other names
2-Methoxy-5-(trifluoromethyl)benzoic acid, 98% (CAS 4864-01-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114HJ6-250mg |
| cas | 4864-01-1 |
| size | 250mg |
| availability | 125g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 10g | 256.40 Pln | |
| Chemat | 25g | 549.20 Pln | |
| Fluorochem | 1g | 148.92 Pln | |
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 310.32 Pln | |
| Fluorochem | 25g | 679.99 Pln | |
| Fluorochem | 100g | 2497.05 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methoxy-5-(trifluoromethyl)benzoic acid (CAS 4864-01-1) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 2-methoxy-5-(trifluoromethyl)benzoic acid. InChIKey: NAKZCKOHULJEID-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 2-methoxy-5-(trifluoromethyl)benzoic acid |
| InChIKey | NAKZCKOHULJEID-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)