Products 2092570-52-8
CAS 2092570-52-8 appears in our catalog under these names: 3-(Difluoromethoxy)-4-fluoro-5-methylbenzoic acid, 95%, 3-(Difluoromethoxy)-4-fluoro-5-methylbenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg.
3-(difluoromethoxy)-4-fluoro-5-methylbenzoic acid (CAS 2092570-52-8) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 3-(difluoromethoxy)-4-fluoro-5-methylbenzoic acid. InChIKey: PIMVGVJILPQLAM-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 3-(difluoromethoxy)-4-fluoro-5-methylbenzoic acid |
| InChIKey | PIMVGVJILPQLAM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)OC(F)F)C(=O)O |
Computed by PubChem (NCBI)