cas: 1514864-84-6 — see every product listed under this CAS number, including other names
2-Methoxy-9,9-dimethyl-9H-fluorene, 98% (CAS 1514864-84-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F864333-5G |
| cas | 1514864-84-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 482.14 Pln | |
| Fluorochem | 10g | 815.36 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-methoxy-9,9-dimethylfluorene (CAS 1514864-84-6) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: 2-methoxy-9,9-dimethylfluorene. InChIKey: ZWBHUKZFZLEKKA-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 2-methoxy-9,9-dimethylfluorene |
| InChIKey | ZWBHUKZFZLEKKA-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)OC)C |
Computed by PubChem (NCBI)