2-Methyl-4-(trifluoromethoxy)phenylboronic acid, 98%
cas: 850033-39-5 — see every product listed under this CAS number, including other names
2-Methyl-4-(trifluoromethoxy)phenylboronic acid, 98% (CAS 850033-39-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A525617-250mg |
| cas | 850033-39-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 670.75 Pln | |
| Ambeed | 1g | 1338.25 Pln | |
| Ambeed | 5g | 6416.81 Pln | |
| Chemat | 100mg | 587.60 Pln | |
| Chemat | 250mg | 971.60 Pln | |
| Chemat | 1g | 2512.40 Pln | |
| Chemat | 5g | 8632.40 Pln | |
| BLDpharm | 100mg | 447.64 Pln | |
| BLDpharm | 250mg | 719.77 Pln | |
| BLDpharm | 1g | 1441.74 Pln | |
| BLDpharm | 5g | 6912.04 Pln | |
| Fluorochem | 250mg | 1794.18 Pln | |
| Fluorochem | 1g | 4652.55 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
[2-methyl-4-(trifluoromethoxy)phenyl]boronic acid (CAS 850033-39-5) is a chemical compound with the molecular formula C8H8BF3O3 and a molecular weight of 219.96 g/mol. IUPAC name: [2-methyl-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: VZNGQLGNHIYWOD-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3 |
|---|---|
| Molecular weight | 219.96 g/mol |
| IUPAC name | [2-methyl-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | VZNGQLGNHIYWOD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Methyl-4-(trifluoromethoxy)benzeneboronic acid, 2-methyl-4-(trifluoromethoxy)phenylboronic acid, [2-methyl-4-(trifluoromethoxy)phenyl]boronic acid, 2-Methyl-4-trifluoromethoxyphenylboronic acid, (2-methyl-4-(trifluoromethoxy)phenyl)boronic acid, 2-Methyl-4-(trifluoromethoxy)phenylboronicacid, Boronic acid,B-[2-methyl-4-(trifluoromethoxy)phenyl]-, Boronic acid, [2-methyl-4-(trifluoromethoxy)phenyl]-