cas: 1309980-29-7 — see every product listed under this CAS number, including other names
2-Methyl-4-trifluoromethoxyphenylboronic acid pinacol ester, 98% (CAS 1309980-29-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F046375-50MG |
| cas | 1309980-29-7 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 325.94 Pln | |
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 487.35 Pln | |
| Fluorochem | 500mg | 893.45 Pln | |
| Fluorochem | 1g | 1132.95 Pln | |
| Fluorochem | 2.5g | 2497.06 Pln | |
| Fluorochem | 5g | 3298.86 Pln | |
| Fluorochem | 10g | 6412.34 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4,4,5,5-tetramethyl-2-[2-methyl-4-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane (CAS 1309980-29-7) is a chemical compound with the molecular formula C14H18BF3O3 and a molecular weight of 302.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[2-methyl-4-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane. InChIKey: QLTJUMXQHFQRIV-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O3 |
|---|---|
| Molecular weight | 302.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[2-methyl-4-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane |
| InChIKey | QLTJUMXQHFQRIV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC(F)(F)F)C |
Computed by PubChem (NCBI)