cas: 80709-80-4 — see every product listed under this CAS number, including other names
2-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid 95% (CAS 80709-80-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A821159-100mg |
| cas | 80709-80-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 987.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A821159 |
2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid (CAS 80709-80-4) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid. InChIKey: ILLLWINWDFYWES-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | ILLLWINWDFYWES-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(O1)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)