cas: 80709-80-4 — see every product listed under this CAS number, including other names
2-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid, 95%, 95% (CAS 80709-80-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G3M6-100mg |
| cas | 80709-80-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1158.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid (CAS 80709-80-4) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid. InChIKey: ILLLWINWDFYWES-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | ILLLWINWDFYWES-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(O1)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)