cas: 5428-54-6 — see every product listed under this CAS number, including other names
2-Methyl-5-nitrophenol, 97% (CAS 5428-54-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078472-10G |
| cas | 5428-54-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 91.65 Pln | |
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 128.10 Pln | |
| Fluorochem | 500g | 351.98 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-methyl-5-nitrophenol (CAS 5428-54-6) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 2-methyl-5-nitrophenol. InChIKey: UMFDLIXUUJMPSI-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 2-methyl-5-nitrophenol |
| InChIKey | UMFDLIXUUJMPSI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)