cas: 5428-54-6 — see every product listed under this CAS number, including other names
2-Methyl-5-nitrophenol, 98%, 98% (CAS 5428-54-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0P5-10g |
| cas | 5428-54-6 |
| size | 10g |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 150.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methyl-5-nitrophenol (CAS 5428-54-6) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 2-methyl-5-nitrophenol. InChIKey: UMFDLIXUUJMPSI-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 2-methyl-5-nitrophenol |
| InChIKey | UMFDLIXUUJMPSI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)