cas: 13073-29-5 — see every product listed under this CAS number, including other names
2-Methyl-6-nitrophenol, 95% (CAS 13073-29-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078473-5G |
| cas | 13073-29-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 362.39 Pln | |
| Fluorochem | 25g | 716.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-methyl-6-nitrophenol (CAS 13073-29-5) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 2-methyl-6-nitrophenol. InChIKey: AQDKZPFDOWHRDZ-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 2-methyl-6-nitrophenol |
| InChIKey | AQDKZPFDOWHRDZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)