CAS 13073-29-5 appears in our catalog under these names: 2-Methyl-6-nitrophenol, 98%, 2–Methyl–6–nitrophenol, 2-Methyl-6-nitrophenol, 2-Methyl-6-nitrophenol 98%, 2-Methyl-6-nitrophenol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 50g, 250g, 500g.
2-methyl-6-nitrophenol (CAS 13073-29-5) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 2-methyl-6-nitrophenol. InChIKey: AQDKZPFDOWHRDZ-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 2-methyl-6-nitrophenol |
| InChIKey | AQDKZPFDOWHRDZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)