cas: 2649399-93-7 — see every product listed under this CAS number, including other names
2-Methylbiphenyl-4-ylboronic acid pinacol ester, ≥95%, ≥95% (CAS 2649399-93-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch133IUQ-1g |
| cas | 2649399-93-7 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3976.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(2-methyl-4-phenylphenyl)-1,3,2-dioxaborolane (CAS 2649399-93-7) is a chemical compound with the molecular formula C19H23BO2 and a molecular weight of 294.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methyl-4-phenylphenyl)-1,3,2-dioxaborolane. InChIKey: VJNVOZIDAWDRNT-UHFFFAOYSA-N.
| Molecular formula | C19H23BO2 |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methyl-4-phenylphenyl)-1,3,2-dioxaborolane |
| InChIKey | VJNVOZIDAWDRNT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)