cas: 2649399-93-7 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3-methyl-(1,1'-biphenyl)-4-yl)-1,3,2-dioxaborolane, 98% (CAS 2649399-93-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1808648-5g |
| cas | 2649399-93-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 25543.63 Pln | |
| AmBeed | 1g | 7178.92 Pln | |
| AmBeed | 10g | 43400.56 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4,4,5,5-tetramethyl-2-(2-methyl-4-phenylphenyl)-1,3,2-dioxaborolane (CAS 2649399-93-7) is a chemical compound with the molecular formula C19H23BO2 and a molecular weight of 294.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methyl-4-phenylphenyl)-1,3,2-dioxaborolane. InChIKey: VJNVOZIDAWDRNT-UHFFFAOYSA-N.
| Molecular formula | C19H23BO2 |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methyl-4-phenylphenyl)-1,3,2-dioxaborolane |
| InChIKey | VJNVOZIDAWDRNT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)