cas: 952319-71-0 — see every product listed under this CAS number, including other names
2-Methylindazole-5-boronic acid, 97% (CAS 952319-71-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 5g, 25g, 1g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | BB-9021-250mg |
| cas | 952319-71-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 1034.03 Pln | |
| Fluorochem | 10g | 1856.66 Pln | |
| Fluorochem | 25g | 3475.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(2-methylindazol-5-yl)boronic acid (CAS 952319-71-0) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (2-methylindazol-5-yl)boronic acid. InChIKey: KVNWFZDGOYSXJG-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (2-methylindazol-5-yl)boronic acid |
| InChIKey | KVNWFZDGOYSXJG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CN(N=C2C=C1)C)(O)O |
Computed by PubChem (NCBI)