cas: 1416374-90-7 — see every product listed under this CAS number, including other names
2-NITRO-4-BROMO-5-CHLOROBENZOIC ACID METHYL ESTER, 98% (CAS 1416374-90-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F859414-100MG |
| cas | 1416374-90-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 575.86 Pln | |
| Fluorochem | 250mg | 903.87 Pln | |
| Fluorochem | 1g | 2143.01 Pln | |
| Fluorochem | 5g | 6318.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-bromo-5-chloro-2-nitrobenzoate (CAS 1416374-90-7) is a chemical compound with the molecular formula C8H5BrClNO4 and a molecular weight of 294.48 g/mol. IUPAC name: methyl 4-bromo-5-chloro-2-nitrobenzoate. InChIKey: VQBVYXVATUOERO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO4 |
|---|---|
| Molecular weight | 294.48 g/mol |
| IUPAC name | methyl 4-bromo-5-chloro-2-nitrobenzoate |
| InChIKey | VQBVYXVATUOERO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1[N+](=O)[O-])Br)Cl |
Computed by PubChem (NCBI)