Products 1082040-47-8

CAS 1082040-47-8 is the registry number for (2-Bromo-4-chloro-6-nitrophenyl)acetic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2-bromo-4-chloro-6-nitrophenyl)acetic acid (CAS 1082040-47-8) is a chemical compound with the molecular formula C8H5BrClNO4 and a molecular weight of 294.48 g/mol. IUPAC name: 2-(2-bromo-4-chloro-6-nitrophenyl)acetic acid. InChIKey: IECUBBSXMVGZTH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5BrClNO4
Molecular weight294.48 g/mol
IUPAC name2-(2-bromo-4-chloro-6-nitrophenyl)acetic acid
InChIKeyIECUBBSXMVGZTH-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1[N+](=O)[O-])CC(=O)O)Br)Cl

Computed by PubChem (NCBI)