Products 1504888-15-6
CAS 1504888-15-6 appears in our catalog under these names: Methyl 3-bromo-4-chloro-5-nitrobenzoate 98%, Methyl 3-bromo-4-chloro-5-nitrobenzoate, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 3-bromo-4-chloro-5-nitrobenzoate (CAS 1504888-15-6) is a chemical compound with the molecular formula C8H5BrClNO4 and a molecular weight of 294.48 g/mol. IUPAC name: methyl 3-bromo-4-chloro-5-nitrobenzoate. InChIKey: NIRMBOFGAVRCAX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO4 |
|---|---|
| Molecular weight | 294.48 g/mol |
| IUPAC name | methyl 3-bromo-4-chloro-5-nitrobenzoate |
| InChIKey | NIRMBOFGAVRCAX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)