Products 1820703-50-1
CAS 1820703-50-1 is the registry number for methyl 5-bromo-4-chloro-2-nitrobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
Methyl 5-bromo-4-chloro-2-nitrobenzoate (CAS 1820703-50-1) is a chemical compound with the molecular formula C8H5BrClNO4 and a molecular weight of 294.48 g/mol. IUPAC name: methyl 5-bromo-4-chloro-2-nitrobenzoate. InChIKey: WKLIFCLIGLIUIB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO4 |
|---|---|
| Molecular weight | 294.48 g/mol |
| IUPAC name | methyl 5-bromo-4-chloro-2-nitrobenzoate |
| InChIKey | WKLIFCLIGLIUIB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1[N+](=O)[O-])Cl)Br |
Computed by PubChem (NCBI)
Synonyms:
methyl 5-bromo-4-chloro-2-nitro-benzoate