Products 2092700-64-4

CAS 2092700-64-4 is the registry number for Methyl 4-bromo-2-chloro-6-nitrobenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 4-bromo-2-chloro-6-nitrobenzoate (CAS 2092700-64-4) is a chemical compound with the molecular formula C8H5BrClNO4 and a molecular weight of 294.48 g/mol. IUPAC name: methyl 4-bromo-2-chloro-6-nitrobenzoate. InChIKey: ZXJOJPPHOCWRGX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5BrClNO4
Molecular weight294.48 g/mol
IUPAC namemethyl 4-bromo-2-chloro-6-nitrobenzoate
InChIKeyZXJOJPPHOCWRGX-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1Cl)Br)[N+](=O)[O-]

Computed by PubChem (NCBI)