CAS 2092700-64-4 is the registry number for Methyl 4-bromo-2-chloro-6-nitrobenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 4-bromo-2-chloro-6-nitrobenzoate (CAS 2092700-64-4) is a chemical compound with the molecular formula C8H5BrClNO4 and a molecular weight of 294.48 g/mol. IUPAC name: methyl 4-bromo-2-chloro-6-nitrobenzoate. InChIKey: ZXJOJPPHOCWRGX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO4 |
|---|---|
| Molecular weight | 294.48 g/mol |
| IUPAC name | methyl 4-bromo-2-chloro-6-nitrobenzoate |
| InChIKey | ZXJOJPPHOCWRGX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Cl)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)