cas: 119137-03-0 — see every product listed under this CAS number, including other names
2-Nitrobenzyl Cyclohexylcarbamate, ≥98%, ≥98% (CAS 119137-03-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119TRE-250mg |
| cas | 119137-03-0 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 890.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(2-nitrophenyl)methyl N-cyclohexylcarbamate (CAS 119137-03-0) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: (2-nitrophenyl)methyl N-cyclohexylcarbamate. InChIKey: NJMCHQONLVUNAM-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | (2-nitrophenyl)methyl N-cyclohexylcarbamate |
| InChIKey | NJMCHQONLVUNAM-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)OCC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)