cas: 20142-87-4 — see every product listed under this CAS number, including other names
2-Nitrophenoxyacetyl Chloride, 95%,RG, 95%,RG (CAS 20142-87-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113DEU-250mg |
| cas | 20142-87-4 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1048.40 Pln |
| purity | 95%,RG |
|---|---|
| delivery time | 3 weeks |
2-(2-nitrophenoxy)acetyl chloride (CAS 20142-87-4) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 2-(2-nitrophenoxy)acetyl chloride. InChIKey: AEWBGACGIKCIJH-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 2-(2-nitrophenoxy)acetyl chloride |
| InChIKey | AEWBGACGIKCIJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OCC(=O)Cl |
Computed by PubChem (NCBI)