2-Nitroresorcinol 99%
cas: 601-89-8 — see every product listed under this CAS number, including other names
2-Nitroresorcinol 99% (CAS 601-89-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A141918-5g |
| cas | 601-89-8 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 515.00 Pln | |
| Ambeed | 500g | 1822.19 Pln | |
| Ambeed | 1000g | 2879.06 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A141918 |
2-nitrobenzene-1,3-diol (CAS 601-89-8) is a chemical compound with the molecular formula C6H5NO4 and a molecular weight of 155.11 g/mol. IUPAC name: 2-nitrobenzene-1,3-diol. InChIKey: ZLCPKMIJYMHZMJ-UHFFFAOYSA-N.
| Molecular formula | C6H5NO4 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 2-nitrobenzene-1,3-diol |
| InChIKey | ZLCPKMIJYMHZMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)