CAS 601-89-8 appears in our catalog under these names: 2–Nitroresorcinol, 2-Nitroresorcinol/ 98%, 2-Nitroresorcinol, 98% , 2-Nitroresorcinol, >99.0%(T)(GC), 2-Nitroresorcinol, 98%. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 100g, 25g, 10g, 50g, 5g, 500g, 1000g, 250g.
2-nitrobenzene-1,3-diol (CAS 601-89-8) is a chemical compound with the molecular formula C6H5NO4 and a molecular weight of 155.11 g/mol. IUPAC name: 2-nitrobenzene-1,3-diol. InChIKey: ZLCPKMIJYMHZMJ-UHFFFAOYSA-N.
| Molecular formula | C6H5NO4 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 2-nitrobenzene-1,3-diol |
| InChIKey | ZLCPKMIJYMHZMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)