cas: 601-89-8 — see every product listed under this CAS number, including other names
2-Nitrobenzene-1,3-diol, 98%, 98% (CAS 601-89-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144F1-5g |
| cas | 601-89-8 |
| size | 5g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 50g | 222.80 Pln | |
| Chemat | 100g | 338.00 Pln | |
| Chemat | 250g | 664.40 Pln | |
| Chemat | 500g | 1166.40 Pln | |
| Chemat | 1kg | 1979.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-nitrobenzene-1,3-diol (CAS 601-89-8) is a chemical compound with the molecular formula C6H5NO4 and a molecular weight of 155.11 g/mol. IUPAC name: 2-nitrobenzene-1,3-diol. InChIKey: ZLCPKMIJYMHZMJ-UHFFFAOYSA-N.
| Molecular formula | C6H5NO4 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 2-nitrobenzene-1,3-diol |
| InChIKey | ZLCPKMIJYMHZMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)