2-Nitroterephthalic acid, 97%
cas: 610-29-7 — see every product listed under this CAS number, including other names
2-Nitroterephthalic acid, 97% (CAS 610-29-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A203509-5g |
| cas | 610-29-7 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 192.38 Pln | |
| Ambeed | 500g | 559.50 Pln | |
| Ambeed | 1kg | 1043.44 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 10g | 203.29 Pln | |
| BLDpharm | 25g | 219.95 Pln | |
| BLDpharm | 100g | 236.61 Pln | |
| BLDpharm | 500g | 547.61 Pln | |
| BLDpharm | 1kg | 1025.22 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-nitroterephthalic acid (CAS 610-29-7) is a chemical compound with the molecular formula C8H5NO6 and a molecular weight of 211.13 g/mol. IUPAC name: 2-nitroterephthalic acid. InChIKey: QUMITRDILMWWBC-UHFFFAOYSA-N.
| Molecular formula | C8H5NO6 |
|---|---|
| Molecular weight | 211.13 g/mol |
| IUPAC name | 2-nitroterephthalic acid |
| InChIKey | QUMITRDILMWWBC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Nitroterephthalic acid, Terephthalic acid, nitro-, 1,4-Benzenedicarboxylic acid, 2-nitro-, 5-Nitroterephthalic acid, 2-Nitroterephthalic acid, 2-nitrobenzene-1,4-dicarboxylic acid, 2-nitroterephthalicacid, 2-nitro-1,4-benzenedicarboxylic acid, Nitroterephthalic acid, purum, >=99.0% (HPLC), 2-Nitro-p-phthalic acid
