Products 1386387-74-1
CAS 1386387-74-1 appears in our catalog under these names: 3-Nitrophthalic-d3 Acid, 99 atom % D, min 98% Chemical Purity, 3-Nitrophthalic acid-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 1 mg.
3,4,5-trideuterio-6-nitrophthalic acid (CAS 1386387-74-1) is a chemical compound with the molecular formula C8H5NO6 and a molecular weight of 214.15 g/mol. IUPAC name: 3,4,5-trideuterio-6-nitrophthalic acid. InChIKey: KFIRODWJCYBBHY-CBYSEHNBSA-N.
| Molecular formula | C8H5NO6 |
|---|---|
| Molecular weight | 214.15 g/mol |
| IUPAC name | 3,4,5-trideuterio-6-nitrophthalic acid |
| InChIKey | KFIRODWJCYBBHY-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[N+](=O)[O-])C(=O)O)C(=O)O)[2H] |
Computed by PubChem (NCBI)
Synonyms:
3,4,5-trideuterio-6-nitrophthalic acid