CAS 611231-60-8 is the registry number for 7–nitrobenzo(d)(1,3)dioxole–4–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg.
7-nitro-1,3-benzodioxole-4-carboxylic acid (CAS 611231-60-8) is a chemical compound with the molecular formula C8H5NO6 and a molecular weight of 211.13 g/mol. IUPAC name: 7-nitro-1,3-benzodioxole-4-carboxylic acid. InChIKey: KHIRFDDYHRRUGO-UHFFFAOYSA-N.
| Molecular formula | C8H5NO6 |
|---|---|
| Molecular weight | 211.13 g/mol |
| IUPAC name | 7-nitro-1,3-benzodioxole-4-carboxylic acid |
| InChIKey | KHIRFDDYHRRUGO-UHFFFAOYSA-N |
| SMILES | C1OC2=C(C=CC(=C2O1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)