cas: 43038-37-5 — see every product listed under this CAS number, including other names
2-Phenoxybenzhydrazide (CAS 43038-37-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009713-250MG |
| cas | 43038-37-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 674.78 Pln | |
| Fluorochem | 25g | 2236.73 Pln |
| delivery time | 2-3 weeks |
|---|
2-phenoxybenzohydrazide (CAS 43038-37-5) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 2-phenoxybenzohydrazide. InChIKey: PIMAJOVNMMNVCZ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 2-phenoxybenzohydrazide |
| InChIKey | PIMAJOVNMMNVCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2C(=O)NN |
Computed by PubChem (NCBI)