cas: 5021-47-6 — see every product listed under this CAS number, including other names
2-Phenyl-1,2,3,4-tetrahydroquinoxaline, 97% (CAS 5021-47-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A436517-5g |
| cas | 5021-47-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 16996.00 Pln | |
| AmBeed | 1g | 4301.50 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-phenyl-1,2,3,4-tetrahydroquinoxaline (CAS 5021-47-6) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: 2-phenyl-1,2,3,4-tetrahydroquinoxaline. InChIKey: GMCNTPSVIZBYSH-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 2-phenyl-1,2,3,4-tetrahydroquinoxaline |
| InChIKey | GMCNTPSVIZBYSH-UHFFFAOYSA-N |
| SMILES | C1C(NC2=CC=CC=C2N1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)