CAS 588-04-5 appears in our catalog under these names: 3,3'-Dimethylazobenzene, 95%, 3,3'–Dimethylazobenzene, 3,3'-Dimethylazobenzene, >98.0%(GC), 3,3'-Azotoluene 98%, 3,3'-Dimethylazobenzene, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 25g.
Bis(3-methylphenyl)diazene (CAS 588-04-5) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: bis(3-methylphenyl)diazene. InChIKey: HPSZIXYLILUGIP-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | bis(3-methylphenyl)diazene |
| InChIKey | HPSZIXYLILUGIP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N=NC2=CC=CC(=C2)C |
Computed by PubChem (NCBI)