Products 1393442-59-5
CAS 1393442-59-5 is the registry number for 2-Methyl-2-(6-methylquinolin-3-yl)propanenitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-methyl-2-(6-methylquinolin-3-yl)propanenitrile (CAS 1393442-59-5) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: 2-methyl-2-(6-methylquinolin-3-yl)propanenitrile. InChIKey: KLDUHFNCXZSJLT-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 2-methyl-2-(6-methylquinolin-3-yl)propanenitrile |
| InChIKey | KLDUHFNCXZSJLT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=CN=C2C=C1)C(C)(C)C#N |
Computed by PubChem (NCBI)