CAS 1335101-83-1 is the registry number for 6-(2,5-Dimethyl-1h-pyrrol-1-yl)-1h-indole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
6-(2,5-dimethylpyrrol-1-yl)-1H-indole (CAS 1335101-83-1) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: 6-(2,5-dimethylpyrrol-1-yl)-1H-indole. InChIKey: ZICYXHGTWSBXCC-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 6-(2,5-dimethylpyrrol-1-yl)-1H-indole |
| InChIKey | ZICYXHGTWSBXCC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC3=C(C=C2)C=CN3)C |
Computed by PubChem (NCBI)