CAS 501-60-0 appears in our catalog under these names: 1,2-Di-p-tolyldiazene, 95%, 1,2-Di-p-tolyldiazene, 95-<97%, 1,2–Di–p–tolyldiazene, 1,2-Di-p-tolyldiazene, >95.0%(GC), 1,2-Di-p-tolyldiazene 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, TCI, Ambeed. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 50g, 100g, 200g.
Bis(4-methylphenyl)diazene (CAS 501-60-0) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: bis(4-methylphenyl)diazene. InChIKey: WNVWWDKUMKBZQV-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | bis(4-methylphenyl)diazene |
| InChIKey | WNVWWDKUMKBZQV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N=NC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)