cas: 15795-20-7 — see every product listed under this CAS number, including other names
2-Propenoic acid, 3-(4-bromophenyl)-, ethyl ester, 96% (CAS 15795-20-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F980096-5G |
| cas | 15795-20-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 10g | 529.00 Pln | |
| Fluorochem | 25g | 877.83 Pln | |
| Fluorochem | 100g | 2502.26 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 3-(4-bromophenyl)prop-2-enoate (CAS 15795-20-7) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: ethyl 3-(4-bromophenyl)prop-2-enoate. InChIKey: YOOKYIPLSLPRTC-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | ethyl 3-(4-bromophenyl)prop-2-enoate |
| InChIKey | YOOKYIPLSLPRTC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=CC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)