cas: 15795-20-7 — see every product listed under this CAS number, including other names
Ethyl trans-4-bromocinnamate, 96%, 96% (CAS 15795-20-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112PUS-100mg |
| cas | 15795-20-7 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 10g | 443.60 Pln | |
| Chemat | 25g | 827.60 Pln | |
| Chemat | 100g | 2738.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-(4-bromophenyl)prop-2-enoate (CAS 15795-20-7) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: ethyl 3-(4-bromophenyl)prop-2-enoate. InChIKey: YOOKYIPLSLPRTC-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | ethyl 3-(4-bromophenyl)prop-2-enoate |
| InChIKey | YOOKYIPLSLPRTC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=CC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)