cas: 845306-08-3 — see every product listed under this CAS number, including other names
2-Pyridinecarboxylic acid, 5-bromo-, 1,1-dimethylethyl ester, 98%, 98% (CAS 845306-08-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119HVE-250mg |
| cas | 845306-08-3 |
| size | 250mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 352.40 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 10g | 544.40 Pln | |
| Chemat | 50g | 1715.60 Pln | |
| Chemat | 100g | 2819.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 5-bromopyridine-2-carboxylate (CAS 845306-08-3) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: tert-butyl 5-bromopyridine-2-carboxylate. InChIKey: GBAJDPJECJPPSP-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | tert-butyl 5-bromopyridine-2-carboxylate |
| InChIKey | GBAJDPJECJPPSP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC=C(C=C1)Br |
Computed by PubChem (NCBI)