CAS 1270310-63-8 appears in our catalog under these names: 2-Amino-3-(4-bromo-2-methylphenyl)propanoic acid, 95%, 2-Amino-3-(4-bromo-2-methylphenyl)propanoic acid, 98%, 2–Amino–3–(4–bromo–2–methylphenyl)propanoic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
2-amino-3-(4-bromo-2-methylphenyl)propanoic acid (CAS 1270310-63-8) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: 2-amino-3-(4-bromo-2-methylphenyl)propanoic acid. InChIKey: XNWPJVXADOXWOV-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 2-amino-3-(4-bromo-2-methylphenyl)propanoic acid |
| InChIKey | XNWPJVXADOXWOV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)CC(C(=O)O)N |
Computed by PubChem (NCBI)