Products 168629-64-9
CAS 168629-64-9 appears in our catalog under these names: tert-Butyl 2-bromonicotinate, 95%, tert-Butyl 2-bromonicotinate, 97%, Tert-Butyl 2-bromonicotinate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 500mg.
Tert-butyl 2-bromopyridine-3-carboxylate (CAS 168629-64-9) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: tert-butyl 2-bromopyridine-3-carboxylate. InChIKey: OUJNDKUAPNBGCN-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | tert-butyl 2-bromopyridine-3-carboxylate |
| InChIKey | OUJNDKUAPNBGCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(N=CC=C1)Br |
Computed by PubChem (NCBI)