Products 1379303-09-9
CAS 1379303-09-9 is the registry number for Ethyl 4-amino-3-bromo-5-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 4-amino-3-bromo-5-methylbenzoate (CAS 1379303-09-9) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: ethyl 4-amino-3-bromo-5-methylbenzoate. InChIKey: PWTLJQURCTVKJW-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | ethyl 4-amino-3-bromo-5-methylbenzoate |
| InChIKey | PWTLJQURCTVKJW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)C)N)Br |
Computed by PubChem (NCBI)