CAS 1259986-39-4 appears in our catalog under these names: 2–Bromo–4–methylphenylalanine, 2-Amino-3-(2-bromo-4-methylphenyl)propanoic acid, 95%, 2-Amino-3-(2-bromo-4-methylphenyl)propanoic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Chemat. Available pack sizes: 100mg, 1g, 250mg.
2-amino-3-(2-bromo-4-methylphenyl)propanoic acid (CAS 1259986-39-4) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: 2-amino-3-(2-bromo-4-methylphenyl)propanoic acid. InChIKey: ZYNHHRLIBMEBBP-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 2-amino-3-(2-bromo-4-methylphenyl)propanoic acid |
| InChIKey | ZYNHHRLIBMEBBP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CC(C(=O)O)N)Br |
Computed by PubChem (NCBI)