CAS 923249-45-0 is the registry number for N-(3-Nitro-6-oxo-1,6-dihydropyridin-2-yl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
N-(3-nitro-6-oxo-1H-pyridin-2-yl)acetamide (CAS 923249-45-0) is a chemical compound with the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. IUPAC name: N-(3-nitro-6-oxo-1H-pyridin-2-yl)acetamide. InChIKey: PKRPEMDJIZOMSG-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O4 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | N-(3-nitro-6-oxo-1H-pyridin-2-yl)acetamide |
| InChIKey | PKRPEMDJIZOMSG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=O)N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)