CAS 1218943-22-6 appears in our catalog under these names: 6-(Methylamino)-5-nitropyridine-3-carboxylic acid, 6-(Methylamino)-5-nitropyridine-3-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 50mg, 0,5g, 5g, 1g.
6-(methylamino)-5-nitropyridine-3-carboxylic acid (CAS 1218943-22-6) is a chemical compound with the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. IUPAC name: 6-(methylamino)-5-nitropyridine-3-carboxylic acid. InChIKey: LRPDEULCJPOZLY-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O4 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | 6-(methylamino)-5-nitropyridine-3-carboxylic acid |
| InChIKey | LRPDEULCJPOZLY-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=N1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)