CAS 1349715-52-1 is the registry number for 5-Nitro-2-(oxetan-3-yloxy)pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
5-nitro-2-(oxetan-3-yloxy)pyrimidine (CAS 1349715-52-1) is a chemical compound with the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. IUPAC name: 5-nitro-2-(oxetan-3-yloxy)pyrimidine. InChIKey: HPOSGZUMRCUCGL-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O4 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | 5-nitro-2-(oxetan-3-yloxy)pyrimidine |
| InChIKey | HPOSGZUMRCUCGL-UHFFFAOYSA-N |
| SMILES | C1C(CO1)OC2=NC=C(C=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)