Products 941716-91-2

CAS 941716-91-2 is the registry number for 2-Pyrrolidin-1-yl-1,3-thiazole-5-carboxylic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.

Structural formula: {0} (CAS {1})

2-pyrrolidin-1-yl-1,3-thiazole-5-carboxylic acid (CAS 941716-91-2) is a chemical compound with the molecular formula C8H10N2O2S and a molecular weight of 198.24 g/mol. IUPAC name: 2-pyrrolidin-1-yl-1,3-thiazole-5-carboxylic acid. InChIKey: KPQGRYOIUITVHX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O2S
Molecular weight198.24 g/mol
IUPAC name2-pyrrolidin-1-yl-1,3-thiazole-5-carboxylic acid
InChIKeyKPQGRYOIUITVHX-UHFFFAOYSA-N
SMILESC1CCN(C1)C2=NC=C(S2)C(=O)O

Computed by PubChem (NCBI)